CAS 103659-91-2 is the registry number for 4-Aminothiochroman 1,1-dioxide hydrochloride, 95+%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride (CAS 103659-91-2) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: 1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride. InChIKey: GKPLTSUHDQQPNM-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride |
| InChIKey | GKPLTSUHDQQPNM-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=CC=CC=C2C1N.Cl |
Computed by PubChem (NCBI)