CAS 1423040-73-6 appears in our catalog under these names: (S)-4-Aminothiochromane 1,1-dioxide hydrochloride, 95%, (4S)-4-Amino-3,4-dihydro-2H-1lambda6-benzothiopyran-1,1-dione hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4S)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride (CAS 1423040-73-6) is a chemical compound with the molecular formula C9H12ClNO2S and a molecular weight of 233.72 g/mol. IUPAC name: (4S)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride. InChIKey: GKPLTSUHDQQPNM-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO2S |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | (4S)-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride |
| InChIKey | GKPLTSUHDQQPNM-QRPNPIFTSA-N |
| SMILES | C1CS(=O)(=O)C2=CC=CC=C2[C@H]1N.Cl |
Computed by PubChem (NCBI)