Products 103752-84-7
CAS 103752-84-7 is the registry number for 2-methyl-3-oxo-3,4-dihydroquinoxaline-6-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-methyl-3-oxo-4H-quinoxaline-6-carboxylic acid (CAS 103752-84-7) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: 2-methyl-3-oxo-4H-quinoxaline-6-carboxylic acid. InChIKey: XOMWCEBTGXHPGO-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 2-methyl-3-oxo-4H-quinoxaline-6-carboxylic acid |
| InChIKey | XOMWCEBTGXHPGO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)C(=O)O)NC1=O |
Computed by PubChem (NCBI)