Products 10380-41-3
CAS 10380-41-3 appears in our catalog under these names: 2-Cyano-3,3-diphenylacrylic Acid, >95% (HPLC), 2–Cyano–3，3–diphenylacrylic acid, 2-Cyano-3，3-diphenylacrylic acid, 98%, 98%. Offered by: TRC, GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 250mg.
2-cyano-3,3-diphenylprop-2-enoic acid (CAS 10380-41-3) is a chemical compound with the molecular formula C16H11NO2 and a molecular weight of 249.26 g/mol. IUPAC name: 2-cyano-3,3-diphenylprop-2-enoic acid. InChIKey: VSXIZXFGQGKZQG-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 2-cyano-3,3-diphenylprop-2-enoic acid |
| InChIKey | VSXIZXFGQGKZQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=C(C#N)C(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
2-cyano-3,3-diphenylacrylic acid, 2-Propenoic acid, 2-cyano-3,3-diphenyl-, 3,3-diphenyl-2-cyanoacrylic acid, 2-cyano-3,3-diphenyl-2-propenoic acid, alpha-Cyano-beta-diphenylacrylic acid, .ALPHA.-CYANO-.BETA.-DIPHENYLACRYLIC ACID, 2-Cyano-3,3-diphenylpropenoic acid, 2-cyano-3,3-diphenylprop-2-enoic acid, 2-cyano-3,3-diphenyl-prop-2-enoic Acid, 2-cyano-3,3-diphenylacrylicacid