CAS 58609-75-9 is the registry number for 1-(4-Biphenylyl)-1H-pyrrole-2,5-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-phenylphenyl)pyrrole-2,5-dione (CAS 58609-75-9) is a chemical compound with the molecular formula C16H11NO2 and a molecular weight of 249.26 g/mol. IUPAC name: 1-(4-phenylphenyl)pyrrole-2,5-dione. InChIKey: RXWKCYQPTDVVSI-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 1-(4-phenylphenyl)pyrrole-2,5-dione |
| InChIKey | RXWKCYQPTDVVSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)