Products 2196203-34-4
CAS 2196203-34-4 is the registry number for 2-Cyano-3,3-diphenylacrylic Acid-d10. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-cyano-3,3-bis(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid (CAS 2196203-34-4) is a chemical compound with the molecular formula C16H11NO2 and a molecular weight of 259.32 g/mol. IUPAC name: 2-cyano-3,3-bis(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid. InChIKey: VSXIZXFGQGKZQG-LHNTUAQVSA-N.
| Molecular formula | C16H11NO2 |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | 2-cyano-3,3-bis(2,3,4,5,6-pentadeuteriophenyl)prop-2-enoic acid |
| InChIKey | VSXIZXFGQGKZQG-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=C(C#N)C(=O)O)C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
2-Cyano-3,3-diphenylacrylic Acid-d10