CAS 31295-36-0 appears in our catalog under these names: 3,4-Diphenyl-1h-pyrrole-2,5-dione, 95%, 3,4–Diphenyl–1h–pyrrole–2,5–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
3,4-diphenylpyrrole-2,5-dione (CAS 31295-36-0) is a chemical compound with the molecular formula C16H11NO2 and a molecular weight of 249.26 g/mol. IUPAC name: 3,4-diphenylpyrrole-2,5-dione. InChIKey: WADCPEMKIBAJHH-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 3,4-diphenylpyrrole-2,5-dione |
| InChIKey | WADCPEMKIBAJHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)