CAS 31970-74-8 is the registry number for Phenyl(5-phenyloxazol-2-yl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Phenyl-(5-phenyl-1,3-oxazol-2-yl)methanone (CAS 31970-74-8) is a chemical compound with the molecular formula C16H11NO2 and a molecular weight of 249.26 g/mol. IUPAC name: phenyl-(5-phenyl-1,3-oxazol-2-yl)methanone. InChIKey: GELOLSPOTXOQFL-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | phenyl-(5-phenyl-1,3-oxazol-2-yl)methanone |
| InChIKey | GELOLSPOTXOQFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)