CAS 1181608-70-7 is the registry number for 2-(Quinolin-8-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-quinolin-8-ylbenzoic acid (CAS 1181608-70-7) is a chemical compound with the molecular formula C16H11NO2 and a molecular weight of 249.26 g/mol. IUPAC name: 2-quinolin-8-ylbenzoic acid. InChIKey: OOCYMRUHZMPNTQ-UHFFFAOYSA-N.
| Molecular formula | C16H11NO2 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 2-quinolin-8-ylbenzoic acid |
| InChIKey | OOCYMRUHZMPNTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC3=C2N=CC=C3)C(=O)O |
Computed by PubChem (NCBI)