CAS 1038381-40-6 is the registry number for 4-((2-Aminothiazol-5-yl)methyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 200mg.
4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoic acid (CAS 1038381-40-6) is a chemical compound with the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. IUPAC name: 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoic acid. InChIKey: FQKYQEQAQULHMK-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2S |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzoic acid |
| InChIKey | FQKYQEQAQULHMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)N)C(=O)O |
Computed by PubChem (NCBI)