CAS 1038409-56-1 is the registry number for 3-((1-(tert-Butoxycarbonyl)piperidin-4-yl)carbamoyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]carbamoyl]benzoic acid (CAS 1038409-56-1) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 348.4 g/mol. IUPAC name: 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]carbamoyl]benzoic acid. InChIKey: PTVWISOJAANKAQ-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O5 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]carbamoyl]benzoic acid |
| InChIKey | PTVWISOJAANKAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NC(=O)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)