Products 1093641-67-8

CAS 1093641-67-8 is the registry number for tert-Butyl 4-{[2-(methoxycarbonyl)phenyl]carbonyl}piperazine-1-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(2-methoxycarbonylbenzoyl)piperazine-1-carboxylate (CAS 1093641-67-8) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 348.4 g/mol. IUPAC name: tert-butyl 4-(2-methoxycarbonylbenzoyl)piperazine-1-carboxylate. InChIKey: JJWMIBDXYAOOOI-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24N2O5
Molecular weight348.4 g/mol
IUPAC nametert-butyl 4-(2-methoxycarbonylbenzoyl)piperazine-1-carboxylate
InChIKeyJJWMIBDXYAOOOI-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C(=O)C2=CC=CC=C2C(=O)OC

Computed by PubChem (NCBI)