CAS 215121-89-4 appears in our catalog under these names: (3S)-4-Boc-1-carboxymethyl-3-benzyl-piperazin-2-one, 96%, (3S)-4-Boc-1-carboxymethyl-3-benzyl-piperazin-2-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
2-[(3S)-3-benzyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]acetic acid (CAS 215121-89-4) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 348.4 g/mol. IUPAC name: 2-[(3S)-3-benzyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]acetic acid. InChIKey: NPWBAMOQBLYFEH-AWEZNQCLSA-N.
| Molecular formula | C18H24N2O5 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-[(3S)-3-benzyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxopiperazin-1-yl]acetic acid |
| InChIKey | NPWBAMOQBLYFEH-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)[C@@H]1CC2=CC=CC=C2)CC(=O)O |
Computed by PubChem (NCBI)