CAS 196083-21-3 appears in our catalog under these names: (R)-1-((S)-2-(((S)-1-Carboxy-3-phenylpropyl)amino)propanoyl)pyrrolidine-2-carboxylic acid, 97%, Enalaprilat EP Impurity B (RSS Isomer). Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 196083-21-3) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 348.4 g/mol. IUPAC name: (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: LZFZMUMEGBBDTC-AEGPPILISA-N.
| Molecular formula | C18H24N2O5 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (2R)-1-[(2S)-2-[[(1S)-1-carboxy-3-phenylpropyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | LZFZMUMEGBBDTC-AEGPPILISA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@@H]1C(=O)O)N[C@@H](CCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)