CAS 53331-43-4 appears in our catalog under these names: Z-Val-Pro-OH, 95%, Z–Val–Pro–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g.
(2S)-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]pyrrolidine-2-carboxylic acid (CAS 53331-43-4) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 348.4 g/mol. IUPAC name: (2S)-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]pyrrolidine-2-carboxylic acid. InChIKey: GPECCBYSVGSBBG-GJZGRUSLSA-N.
| Molecular formula | C18H24N2O5 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | GPECCBYSVGSBBG-GJZGRUSLSA-N |
| SMILES | CC(C)[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)