CAS 109579-23-9 is the registry number for Boc-(3s,4s)-4-amino-3-hydroxy-5-(1h-indol-3-yl)-pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3S,4S)-3-hydroxy-5-(1H-indol-3-yl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 109579-23-9) is a chemical compound with the molecular formula C18H24N2O5 and a molecular weight of 348.4 g/mol. IUPAC name: (3S,4S)-3-hydroxy-5-(1H-indol-3-yl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: QZHZQDCALLUGIO-GJZGRUSLSA-N.
| Molecular formula | C18H24N2O5 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (3S,4S)-3-hydroxy-5-(1H-indol-3-yl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | QZHZQDCALLUGIO-GJZGRUSLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)[C@H](CC(=O)O)O |
Computed by PubChem (NCBI)