CAS 103854-56-4 appears in our catalog under these names: 1-Quinolin-5-ylethanone, 95+%, 95+%, 1-(Quinolin-5-yl)ethan-1-one, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
1-quinolin-5-ylethanone (CAS 103854-56-4) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-quinolin-5-ylethanone. InChIKey: YSGOYTDRBSUDIA-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-quinolin-5-ylethanone |
| InChIKey | YSGOYTDRBSUDIA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C=CC=NC2=CC=C1 |
Computed by PubChem (NCBI)