CAS 1039334-67-2 appears in our catalog under these names: 2-(4-Amino-2-fluorophenoxy)benzonitrile, 2-(4-Amino-2-fluorophenoxy)benzonitrile, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 10g.
2-(4-amino-2-fluorophenoxy)benzonitrile (CAS 1039334-67-2) is a chemical compound with the molecular formula C13H9FN2O and a molecular weight of 228.22 g/mol. IUPAC name: 2-(4-amino-2-fluorophenoxy)benzonitrile. InChIKey: LWCBMXFEHUHNTC-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(4-amino-2-fluorophenoxy)benzonitrile |
| InChIKey | LWCBMXFEHUHNTC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OC2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)