CAS 112291-47-1 is the registry number for 2-(1H-Benzo[d]imidazol-2-yl)-4-fluorophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
2-(1H-benzimidazol-2-yl)-4-fluorophenol (CAS 112291-47-1) is a chemical compound with the molecular formula C13H9FN2O and a molecular weight of 228.22 g/mol. IUPAC name: 2-(1H-benzimidazol-2-yl)-4-fluorophenol. InChIKey: UVJSLXFXDCVSRL-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(1H-benzimidazol-2-yl)-4-fluorophenol |
| InChIKey | UVJSLXFXDCVSRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)C3=C(C=CC(=C3)F)O |
Computed by PubChem (NCBI)