CAS 313527-46-7 appears in our catalog under these names: 2-(2-Fluorophenyl)-1,3-benzoxazol-5-amine, 95%, 2-(2-Fluorophenyl)-1,3-benzoxazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(2-fluorophenyl)-1,3-benzoxazol-5-amine (CAS 313527-46-7) is a chemical compound with the molecular formula C13H9FN2O and a molecular weight of 228.22 g/mol. IUPAC name: 2-(2-fluorophenyl)-1,3-benzoxazol-5-amine. InChIKey: MHKZGGXTFFGCGC-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | MHKZGGXTFFGCGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(O2)C=CC(=C3)N)F |
Computed by PubChem (NCBI)