CAS 1134316-89-4 is the registry number for 2-(3-Fluorophenyl)-1,3-benzoxazol-6-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3-fluorophenyl)-1,3-benzoxazol-6-amine (CAS 1134316-89-4) is a chemical compound with the molecular formula C13H9FN2O and a molecular weight of 228.22 g/mol. IUPAC name: 2-(3-fluorophenyl)-1,3-benzoxazol-6-amine. InChIKey: ZMYNPRHHXAQZEN-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1,3-benzoxazol-6-amine |
| InChIKey | ZMYNPRHHXAQZEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC3=C(O2)C=C(C=C3)N |
Computed by PubChem (NCBI)