CAS 116248-10-3 appears in our catalog under these names: 2-(4-Fluorophenyl)-1,3-benzoxazol-5-amine, 95%, 2–(4–fluorophenyl)benzo(d)oxazol–5–amine, 2-(4-FLUOROPHENYL)-1,3-BENZOXAZOL-5-AMINE, 97%, 97%, 2-(4-Fluoro-phenyl)-benzooxazol-5-ylamine. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(4-fluorophenyl)-1,3-benzoxazol-5-amine (CAS 116248-10-3) is a chemical compound with the molecular formula C13H9FN2O and a molecular weight of 228.22 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-benzoxazol-5-amine. InChIKey: OHKSDBATRIWCTK-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | OHKSDBATRIWCTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)N)F |
Computed by PubChem (NCBI)