Products 1134316-91-8
CAS 1134316-91-8 appears in our catalog under these names: 2-(4-Fluorophenyl)-1,3-benzoxazol-6-amine, 95%, 2-(4-Fluorophenyl)-1,3-benzoxazol-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(4-fluorophenyl)-1,3-benzoxazol-6-amine (CAS 1134316-91-8) is a chemical compound with the molecular formula C13H9FN2O and a molecular weight of 228.22 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-benzoxazol-6-amine. InChIKey: HVFPDOLMDLRRSY-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2O |
|---|---|
| Molecular weight | 228.22 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-benzoxazol-6-amine |
| InChIKey | HVFPDOLMDLRRSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=C(C=C3)N)F |
Computed by PubChem (NCBI)