Products 103954-24-1
CAS 103954-24-1 appears in our catalog under these names: ((S)-1-carboxyethyl)-D-phenylalanine hydrochloride, (2S)-2-((1-Carboxyethyl)amino)-3-phenylpropanoic acid hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 5g, 50mg.
(2S)-2-(1-carboxyethylamino)-3-phenylpropanoic acid;hydrochloride (CAS 103954-24-1) is a chemical compound with the molecular formula C12H16ClNO4 and a molecular weight of 273.71 g/mol. IUPAC name: (2S)-2-(1-carboxyethylamino)-3-phenylpropanoic acid;hydrochloride. InChIKey: BPUVMMXNTHPOJN-LQRGNCEWSA-N.
| Molecular formula | C12H16ClNO4 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | (2S)-2-(1-carboxyethylamino)-3-phenylpropanoic acid;hydrochloride |
| InChIKey | BPUVMMXNTHPOJN-LQRGNCEWSA-N |
| SMILES | CC(C(=O)O)N[C@@H](CC1=CC=CC=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)