CAS 1039847-82-9 appears in our catalog under these names: 2-(Chloromethyl)thieno(2,3-d)pyrimidin-4(1H)-one, 97%, 2-(Chloromethyl)-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
2-(chloromethyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1039847-82-9) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 2-(chloromethyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: FRKMPZJCCOHFST-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 2-(chloromethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | FRKMPZJCCOHFST-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=O)NC(=N2)CCl |
Computed by PubChem (NCBI)