CAS 62773-09-5 appears in our catalog under these names: 7-(Chloromethyl)-5h-[1,3]thiazolo[3,2-a]pyrimidin-5-one, 95%, 7-(Chloromethyl)-5H-thiazolo[3,2-a]pyrimidin-5-one 95%, 7-(Chloromethyl)-5H-thiazolo[3,2-a]pyrimidin-5-one, 98%, 98%, 7-(chloromethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 2.5g, 10g.
7-(chloromethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CAS 62773-09-5) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 7-(chloromethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one. InChIKey: WANAHALOOUKFKI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 7-(chloromethyl)-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| InChIKey | WANAHALOOUKFKI-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC(=CC(=O)N21)CCl |
Computed by PubChem (NCBI)