CAS 1206716-60-0 is the registry number for 6-Chloro-2-(methylthio)oxazolo[5,4-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 250mg.
6-chloro-2-methylsulfanyl-[1,3]oxazolo[5,4-b]pyridine (CAS 1206716-60-0) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 6-chloro-2-methylsulfanyl-[1,3]oxazolo[5,4-b]pyridine. InChIKey: JFZJWIAIEKPATO-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 6-chloro-2-methylsulfanyl-[1,3]oxazolo[5,4-b]pyridine |
| InChIKey | JFZJWIAIEKPATO-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(O1)N=CC(=C2)Cl |
Computed by PubChem (NCBI)