Products 1196154-04-7
CAS 1196154-04-7 appears in our catalog under these names: 2-Chloro-5-methoxy-thiazolo[5,4-b]pyridine, 95%, 2-Chloro-5-methoxythiazolo(5,4-b)pyridine, 95+%, 2-Chloro-5-methoxy-(1,3)thiazolo(5,4-b)pyridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-chloro-5-methoxy-[1,3]thiazolo[5,4-b]pyridine (CAS 1196154-04-7) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 2-chloro-5-methoxy-[1,3]thiazolo[5,4-b]pyridine. InChIKey: OULPUEUXOWTDDC-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 2-chloro-5-methoxy-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | OULPUEUXOWTDDC-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)N=C(S2)Cl |
Computed by PubChem (NCBI)