CAS 727374-87-0 appears in our catalog under these names: 2-(Chloromethyl)-5-(thiophen-2-yl)-1,3,4-oxadiazole, 95%, 2-(Chloromethyl)-5-thien-2-yl-1,3,4-oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 5g.
2-(chloromethyl)-5-thiophen-2-yl-1,3,4-oxadiazole (CAS 727374-87-0) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 2-(chloromethyl)-5-thiophen-2-yl-1,3,4-oxadiazole. InChIKey: DKJUUMCXMOJMEI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 2-(chloromethyl)-5-thiophen-2-yl-1,3,4-oxadiazole |
| InChIKey | DKJUUMCXMOJMEI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)