CAS 63417-81-2 appears in our catalog under these names: 5-(Chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole, 95%, 5-(Chloromethyl)-3-thien-2-yl-1,2,4-oxadiazole, 5-(Chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole, 95% , 5-(Chloromethyl)-3-(2-thienyl)-1,2,4-oxadiazole, ≥98%, ≥98%, 5-Chloromethyl-3-thiophen-2-yl-[1,2,4]oxadiazole, 95%. Offered by: Combi-blocks, Biosynth, Thermo Scientific, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250MG, 5mg, 10mg, 25mg, 50mg.
5-(chloromethyl)-3-thiophen-2-yl-1,2,4-oxadiazole (CAS 63417-81-2) is a chemical compound with the molecular formula C7H5ClN2OS and a molecular weight of 200.65 g/mol. IUPAC name: 5-(chloromethyl)-3-thiophen-2-yl-1,2,4-oxadiazole. InChIKey: YOUDLOUFERNGRO-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2OS |
|---|---|
| Molecular weight | 200.65 g/mol |
| IUPAC name | 5-(chloromethyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| InChIKey | YOUDLOUFERNGRO-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)