CAS 1039867-83-8 appears in our catalog under these names: 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethanamine, 97%, 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-amine, 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethanamine, 97%, 97%, 1-(3-Bromo-4-methoxyphenyl)-2,2,2-trifluoroethan-1-amine, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 250mg, 500mg, 1g, 2.5g.
1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanamine (CAS 1039867-83-8) is a chemical compound with the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. IUPAC name: 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanamine. InChIKey: DZWDZYOJEYNLEP-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3NO |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 1-(3-bromo-4-methoxyphenyl)-2,2,2-trifluoroethanamine |
| InChIKey | DZWDZYOJEYNLEP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(F)(F)F)N)Br |
Computed by PubChem (NCBI)