Products 1334607-80-5
CAS 1334607-80-5 appears in our catalog under these names: 5-bromo-2-isopropoxy-3-(trifluoromethyl)pyridine, 96%, 5-Bromo-2-isopropoxy-3-(trifluoromethyl)pyridine 96%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 250mg.
5-bromo-2-propan-2-yloxy-3-(trifluoromethyl)pyridine (CAS 1334607-80-5) is a chemical compound with the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. IUPAC name: 5-bromo-2-propan-2-yloxy-3-(trifluoromethyl)pyridine. InChIKey: ZTMMTWIFRLZUDM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3NO |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 5-bromo-2-propan-2-yloxy-3-(trifluoromethyl)pyridine |
| InChIKey | ZTMMTWIFRLZUDM-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)