Products 1039920-55-2
CAS 1039920-55-2 is the registry number for 5-Bromo-2-(2,2,2-trifluoro-ethoxy)-benzylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]methanamine (CAS 1039920-55-2) is a chemical compound with the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. IUPAC name: [5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]methanamine. InChIKey: IYUPWGIHESJJNO-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3NO |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | [5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]methanamine |
| InChIKey | IYUPWGIHESJJNO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CN)OCC(F)(F)F |
Computed by PubChem (NCBI)