Products 2301067-12-7
CAS 2301067-12-7 is the registry number for 3-Bromo-4-(2,2-difluoro-propoxy)-5-fluoro-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-4-(2,2-difluoropropoxy)-5-fluoroaniline (CAS 2301067-12-7) is a chemical compound with the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. IUPAC name: 3-bromo-4-(2,2-difluoropropoxy)-5-fluoroaniline. InChIKey: BXRMEMHVGPOEMY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3NO |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 3-bromo-4-(2,2-difluoropropoxy)-5-fluoroaniline |
| InChIKey | BXRMEMHVGPOEMY-UHFFFAOYSA-N |
| SMILES | CC(COC1=C(C=C(C=C1Br)N)F)(F)F |
Computed by PubChem (NCBI)