Products 216766-04-0
CAS 216766-04-0 is the registry number for 3-Bromo-2-isopropoxy-5-(trifluoromethyl)pyridine, 95+%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
3-bromo-2-propan-2-yloxy-5-(trifluoromethyl)pyridine (CAS 216766-04-0) is a chemical compound with the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. IUPAC name: 3-bromo-2-propan-2-yloxy-5-(trifluoromethyl)pyridine. InChIKey: BHHAXQRZFPLLCW-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3NO |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | 3-bromo-2-propan-2-yloxy-5-(trifluoromethyl)pyridine |
| InChIKey | BHHAXQRZFPLLCW-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=N1)C(F)(F)F)Br |
Computed by PubChem (NCBI)