Products 1539859-64-7
CAS 1539859-64-7 is the registry number for 2-Bromo-5-(2,2,2-trifluoroethoxy)benzylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2-bromo-5-(2,2,2-trifluoroethoxy)phenyl]methanamine (CAS 1539859-64-7) is a chemical compound with the molecular formula C9H9BrF3NO and a molecular weight of 284.07 g/mol. IUPAC name: [2-bromo-5-(2,2,2-trifluoroethoxy)phenyl]methanamine. InChIKey: KZBGQUFENDMDHX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3NO |
|---|---|
| Molecular weight | 284.07 g/mol |
| IUPAC name | [2-bromo-5-(2,2,2-trifluoroethoxy)phenyl]methanamine |
| InChIKey | KZBGQUFENDMDHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)CN)Br |
Computed by PubChem (NCBI)