CAS 1227606-22-5 appears in our catalog under these names: 5–Chloro–2–(chloromethyl)–3–(trifluoromethyl)pyridine, 5-Chloro-2-(chloromethyl)-3-(trifluoromethyl)pyridine, 95%, 5-Chloro-2-(chloromethyl)-3-(trifluoromethyl)pyridine 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg.
5-chloro-2-(chloromethyl)-3-(trifluoromethyl)pyridine (CAS 1227606-22-5) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 5-chloro-2-(chloromethyl)-3-(trifluoromethyl)pyridine. InChIKey: VETYBESERYLQPV-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 5-chloro-2-(chloromethyl)-3-(trifluoromethyl)pyridine |
| InChIKey | VETYBESERYLQPV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)CCl)Cl |
Computed by PubChem (NCBI)