Products 1196153-15-7
CAS 1196153-15-7 is the registry number for 2–Chloro–6–chloromethyl–4–trifluoromethyl–pyridine. Offered by: GLPBio. Available pack sizes: 100mg, 50mg.
2-chloro-6-(chloromethyl)-4-(trifluoromethyl)pyridine (CAS 1196153-15-7) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 2-chloro-6-(chloromethyl)-4-(trifluoromethyl)pyridine. InChIKey: UHRDONXHHAJWAZ-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 2-chloro-6-(chloromethyl)-4-(trifluoromethyl)pyridine |
| InChIKey | UHRDONXHHAJWAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1CCl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)