CAS 24279-39-8 appears in our catalog under these names: 2,6-Dichloro-4-(trifluoromethyl)aniline, >95% (HPLC), 2,6–Dichloro–4–trifluoromethylaniline, 2,6-Dichloro-4-(trifluoromethyl)aniline, 4-Amino-3,5-dichlorobenzotrifluoride, >98.0%(GC), 2,6-Dichloro-4-(trifluoromethyl)aniline 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 10g, 25g, 5g, 100g, 500g, 250g, 1000g, 2000g.
2,6-dichloro-4-(trifluoromethyl)aniline (CAS 24279-39-8) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 2,6-dichloro-4-(trifluoromethyl)aniline. InChIKey: ITNMAZSPBLRJLU-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 2,6-dichloro-4-(trifluoromethyl)aniline |
| InChIKey | ITNMAZSPBLRJLU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)C(F)(F)F |
Computed by PubChem (NCBI)