Products 6656-72-0
CAS 6656-72-0 is the registry number for 2,6-Dichloro-3-(trifluoromethyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,6-dichloro-3-(trifluoromethyl)aniline (CAS 6656-72-0) is a chemical compound with the molecular formula C7H4Cl2F3N and a molecular weight of 230.01 g/mol. IUPAC name: 2,6-dichloro-3-(trifluoromethyl)aniline. InChIKey: NKCROTQPQZXJOL-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3N |
|---|---|
| Molecular weight | 230.01 g/mol |
| IUPAC name | 2,6-dichloro-3-(trifluoromethyl)aniline |
| InChIKey | NKCROTQPQZXJOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)N)Cl |
Computed by PubChem (NCBI)