CAS 1039951-74-0 appears in our catalog under these names: 1-(2,6-Dichlorophenyl)cyclobutane-1-carboxylic acid, 98%, 1-(2,6-Dichlorophenyl)cyclobutane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,6-dichlorophenyl)cyclobutane-1-carboxylic acid (CAS 1039951-74-0) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)cyclobutane-1-carboxylic acid. InChIKey: PLQRUZIHVUOPFC-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | PLQRUZIHVUOPFC-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C=CC=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)