Products 144900-34-5
CAS 144900-34-5 appears in our catalog under these names: Ciprofibrate Impurity 1, Acetyl Ciprofibrate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
[4-(2,2-dichlorocyclopropyl)phenyl] acetate (CAS 144900-34-5) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: [4-(2,2-dichlorocyclopropyl)phenyl] acetate. InChIKey: KOJAPEXFANADPV-UHFFFAOYSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | [4-(2,2-dichlorocyclopropyl)phenyl] acetate |
| InChIKey | KOJAPEXFANADPV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2CC2(Cl)Cl |
Computed by PubChem (NCBI)