Products 82475-77-2

CAS 82475-77-2 is the registry number for 3-(3,4-Dichloro-phenyl)-acrylic acid ethyl ester, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

Ethyl (E)-3-(3,4-dichlorophenyl)prop-2-enoate (CAS 82475-77-2) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: ethyl (E)-3-(3,4-dichlorophenyl)prop-2-enoate. InChIKey: HQNJBIBRMKGXHM-GQCTYLIASA-N.

Identity
Molecular formulaC11H10Cl2O2
Molecular weight245.10 g/mol
IUPAC nameethyl (E)-3-(3,4-dichlorophenyl)prop-2-enoate
InChIKeyHQNJBIBRMKGXHM-GQCTYLIASA-N
SMILESCCOC(=O)/C=C/C1=CC(=C(C=C1)Cl)Cl

Computed by PubChem (NCBI)