CAS 59507-30-1 is the registry number for (E)-Ethyl 3-(2,6-dichlorophenyl)acrylate, 97%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Ethyl (E)-3-(2,6-dichlorophenyl)prop-2-enoate (CAS 59507-30-1) is a chemical compound with the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. IUPAC name: ethyl (E)-3-(2,6-dichlorophenyl)prop-2-enoate. InChIKey: LUUHRZVWQLCAAC-VOTSOKGWSA-N.
| Molecular formula | C11H10Cl2O2 |
|---|---|
| Molecular weight | 245.10 g/mol |
| IUPAC name | ethyl (E)-3-(2,6-dichlorophenyl)prop-2-enoate |
| InChIKey | LUUHRZVWQLCAAC-VOTSOKGWSA-N |
| SMILES | CCOC(=O)/C=C/C1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)