Products 1039976-04-9
CAS 1039976-04-9 is the registry number for 1-(2-Amino-2-oxoethyl)-1H-benzo[d]imidazole-5-carboxylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 100mg, 1g, 50mg, 250mg.
1-(2-amino-2-oxoethyl)benzimidazole-5-carboxylic acid (CAS 1039976-04-9) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 1-(2-amino-2-oxoethyl)benzimidazole-5-carboxylic acid. InChIKey: GVVKXFANMHTPIJ-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 1-(2-amino-2-oxoethyl)benzimidazole-5-carboxylic acid |
| InChIKey | GVVKXFANMHTPIJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)N=CN2CC(=O)N |
Computed by PubChem (NCBI)