CAS 1040401-18-0 is the registry number for 4-Mercaptomethyl dipicolinic acid. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg.
4-(sulfanylmethyl)pyridine-2,6-dicarboxylic acid (CAS 1040401-18-0) is a chemical compound with the molecular formula C8H7NO4S and a molecular weight of 213.21 g/mol. IUPAC name: 4-(sulfanylmethyl)pyridine-2,6-dicarboxylic acid. InChIKey: WSVZILXOOFJPGD-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4S |
|---|---|
| Molecular weight | 213.21 g/mol |
| IUPAC name | 4-(sulfanylmethyl)pyridine-2,6-dicarboxylic acid |
| InChIKey | WSVZILXOOFJPGD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1C(=O)O)C(=O)O)CS |
Computed by PubChem (NCBI)