CAS 104091-08-9 appears in our catalog under these names: Fmoc–D–Glu(OtBu)–OH, Fmoc-D-Glu(OtBu)-OH*H2O, N-Fmoc-D-glutamic acid 5-tert-butyl ester, 98% , Fmoc-D-Glu(OtBu)-OH, 98.00%, Fmoc-D-Glu(OtBu)-OH. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat, Biosynth. Available pack sizes: 100g, 25g, 5g, 250g, 0,25kg, 0,5kg, 1g, 10g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 104091-08-9) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: OTKXCALUHMPIGM-HXUWFJFHSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | OTKXCALUHMPIGM-HXUWFJFHSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)