CAS 104116-22-5 is the registry number for 5-Bromo-4-(2,5-dimethylphenyl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine (CAS 104116-22-5) is a chemical compound with the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. IUPAC name: 5-bromo-4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine. InChIKey: PTISVONDFMGSIZ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2S |
|---|---|
| Molecular weight | 283.19 g/mol |
| IUPAC name | 5-bromo-4-(2,5-dimethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | PTISVONDFMGSIZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2=C(SC(=N2)N)Br |
Computed by PubChem (NCBI)