CAS 863000-91-3 is the registry number for 4-Bromo-2-pyrrolidin-1-yl-1,3-benzothiazole. Offered by: TRC. Available pack sizes: 250mg.
4-bromo-2-pyrrolidin-1-yl-1,3-benzothiazole (CAS 863000-91-3) is a chemical compound with the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. IUPAC name: 4-bromo-2-pyrrolidin-1-yl-1,3-benzothiazole. InChIKey: WAYNPMSWDJISPY-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2S |
|---|---|
| Molecular weight | 283.19 g/mol |
| IUPAC name | 4-bromo-2-pyrrolidin-1-yl-1,3-benzothiazole |
| InChIKey | WAYNPMSWDJISPY-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=NC3=C(S2)C=CC=C3Br |
Computed by PubChem (NCBI)