CAS 1154374-43-2 is the registry number for 5-(3-Bromobenzyl)-4-methylthiazol-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
5-[(3-bromophenyl)methyl]-4-methyl-1,3-thiazol-2-amine (CAS 1154374-43-2) is a chemical compound with the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. IUPAC name: 5-[(3-bromophenyl)methyl]-4-methyl-1,3-thiazol-2-amine. InChIKey: XKQIUSPCVXPJQA-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2S |
|---|---|
| Molecular weight | 283.19 g/mol |
| IUPAC name | 5-[(3-bromophenyl)methyl]-4-methyl-1,3-thiazol-2-amine |
| InChIKey | XKQIUSPCVXPJQA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)